C15H27BrO2 — CID 59289029
(3-bromo-2,2-dimethylpropyl) 4-propylcyclohexane-1-carboxylate (PubChem CID 59289029) has the molecular formula C15H27BrO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is (3-bromo-2,2-dimethylpropyl) 4-propylcyclohexane-1-carboxylate.
| Compound Name | (3-bromo-2,2-dimethylpropyl) 4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59289029 |
| Molecular Formula | C15H27BrO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (3-bromo-2,2-dimethylpropyl) 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C(=O)OCC(C)(C)CBr)CC1 |
| InChI | InChI=1S/C15H27BrO2/c1-4-5-12-6-8-13(9-7-12)14(17)18-11-15(2,3)10-16/h12-13H,4-11H2,1-3H3 |
| InChIKey | NXIAHOUUBHPESG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|