About 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate
2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 134192374) has the molecular formula C14H23F3O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate.
Analyze 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate?
The IUPAC name of 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate (CID 134192374) is 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate.
What is the SMILES notation for 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate?
The canonical SMILES for 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate is CCC(C)(C)COC(=O)C1CCC(C(F)(F)F)CC1.
What is the InChIKey of 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate?
The InChIKey is MFONTYXUOOASEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F3O2/c1-4-13(2,3)9-19-12(18)10-5-7-11(8-6-10)14(15,16)17/h10-11H,4-9H2,1-3H3.
What are the key properties of 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate?
2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate has a molecular weight of 280.33 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutyl 4-(trifluoromethyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 134192374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).