C10H12N5O8P — CID 59289374
[(E)-2-[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 59289374) has the molecular formula C10H12N5O8P and a molecular weight of 361.21 g/mol. Its IUPAC name is [(E)-2-[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 59289374 |
| Molecular Formula | C10H12N5O8P |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | [(E)-2-[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | [N-]=[N+]=N[C@]1(/C=C/P(=O)(O)O)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H12N5O8P/c11-14-13-10(2-4-24(20,21)22)7(18)6(17)8(23-10)15-3-1-5(16)12-9(15)19/h1-4,6-8,17-18H,(H,12,16,19)(H2,20,21,22)/b4-2+/t6-,7+,8-,10-/m1/s1 |
| InChIKey | XZECTFKFNLTVSI-CCGAUDCKSA-N |
| XLogP | -1.51 |
| TPSA | 210.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|