C35H29IrN4O — CID 59294210
iridium(3+);bis(2-phenylpyridine);4-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]phenol (PubChem CID 59294210) has the molecular formula C35H29IrN4O and a molecular weight of 713.86 g/mol. Its IUPAC name is iridium(3+);bis(2-phenylpyridine);4-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]phenol.
| Compound Name | iridium(3+);bis(2-phenylpyridine);4-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]phenol |
|---|---|
| PubChem CID | 59294210 |
| Molecular Formula | C35H29IrN4O |
| Molecular Weight | 713.86 g/mol |
| Exact Mass | 714.20 |
| IUPAC Name | iridium(3+);bis(2-phenylpyridine);4-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]phenol |
| SMILES | Oc1ccc(CC/N=C/c2ccc[n-]2)cc1.[Ir+3].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C13H13N2O.2C11H8N.Ir/c16-13-5-3-11(4-6-13)7-9-14-10-12-2-1-8-15-12;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-6,8,10H,7,9H2,(H-,14,15,16);2*1-6,8-9H;/q3*-1;+3 |
| InChIKey | NUPGUOIRIXLQSN-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.86 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|