C14H19N3O6 — CID 59295166
[acetyloxy-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazin-2-yl]methyl] acetate (PubChem CID 59295166) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is [acetyloxy-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazin-2-yl]methyl] acetate.
| Compound Name | [acetyloxy-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazin-2-yl]methyl] acetate |
|---|---|
| PubChem CID | 59295166 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [acetyloxy-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazin-2-yl]methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)c1cnc(NC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C14H19N3O6/c1-8(18)21-12(22-9(2)19)10-6-16-11(7-15-10)17-13(20)23-14(3,4)5/h6-7,12H,1-5H3,(H,16,17,20) |
| InChIKey | RLUUAULAGJZOOJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|