C7H12N3NaO3S — CID 59296863
sodium 3-(3-ethyl-1,2,4-triazol-4-yl)propane-1-sulfonate (PubChem CID 59296863) has the molecular formula C7H12N3NaO3S and a molecular weight of 241.25 g/mol. Its IUPAC name is sodium 3-(3-ethyl-1,2,4-triazol-4-yl)propane-1-sulfonate.
| Compound Name | sodium 3-(3-ethyl-1,2,4-triazol-4-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 59296863 |
| Molecular Formula | C7H12N3NaO3S |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | sodium 3-(3-ethyl-1,2,4-triazol-4-yl)propane-1-sulfonate |
| SMILES | CCc1nncn1CCCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H13N3O3S.Na/c1-2-7-9-8-6-10(7)4-3-5-14(11,12)13;/h6H,2-5H2,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | AIHNDSWRCFWHIE-UHFFFAOYSA-M |
| XLogP | -3.22 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|