C10H16O4 — CID 59299324
7-methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (PubChem CID 59299324) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 7-methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | 7-methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 59299324 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 7-methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| SMILES | CC1CC2(CCC1C(=O)O)OCCO2 |
| InChI | InChI=1S/C10H16O4/c1-7-6-10(13-4-5-14-10)3-2-8(7)9(11)12/h7-8H,2-6H2,1H3,(H,11,12) |
| InChIKey | IVOFHXHUQNMGGW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |