C18H17ClN4O — CID 59300807
2-(2-chloro-4-pyridinyl)-5-ethyl-7,7-dimethyl-1H-pyrrolo[2,3-f]benzimidazol-6-one (PubChem CID 59300807) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 2-(2-chloro-4-pyridinyl)-5-ethyl-7,7-dimethyl-1H-pyrrolo[2,3-f]benzimidazol-6-one.
| Compound Name | 2-(2-chloro-4-pyridinyl)-5-ethyl-7,7-dimethyl-1H-pyrrolo[2,3-f]benzimidazol-6-one |
|---|---|
| PubChem CID | 59300807 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-(2-chloro-4-pyridinyl)-5-ethyl-7,7-dimethyl-1H-pyrrolo[2,3-f]benzimidazol-6-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc3[nH]c(-c4ccnc(Cl)c4)nc3cc21 |
| InChI | InChI=1S/C18H17ClN4O/c1-4-23-14-9-13-12(8-11(14)18(2,3)17(23)24)21-16(22-13)10-5-6-20-15(19)7-10/h5-9H,4H2,1-3H3,(H,21,22) |
| InChIKey | CNYDZQZCOOUZQU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|