About iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one
iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one (PubChem CID 59302087) has the molecular formula C12H6IrNO2-
and a molecular weight of 388.40 g/mol. Its IUPAC name is iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one.
Molecular Properties
| Compound Name | iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one |
| PubChem CID | 59302087 |
| Molecular Formula | C12H6IrNO2- |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one |
| SMILES | O=c1oc2cccnc2c2[c-]cccc12.[Ir] |
| InChI | InChI=1S/C12H6NO2.Ir/c14-12-9-5-2-1-4-8(9)11-10(15-12)6-3-7-13-11;/h1-3,5-7H;/q-1; |
| InChIKey | FLQISNJWKJYGKZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one?
The IUPAC name of iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one (CID 59302087) is iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one.
What is the SMILES notation for iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one?
The canonical SMILES for iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one is O=c1oc2cccnc2c2[c-]cccc12.[Ir].
What is the InChIKey of iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one?
The InChIKey is FLQISNJWKJYGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6NO2.Ir/c14-12-9-5-2-1-4-8(9)11-10(15-12)6-3-7-13-11;/h1-3,5-7H;/q-1;.
What are the key properties of iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one?
iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one has a molecular weight of 388.40 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;10H-isochromeno[4,3-b]pyridin-10-id-6-one is sourced from PubChem (CID 59302087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).