C25H23N3O3S — CID 59303132
ethyl 3-benzyl-2-methylsulfanyl-5-(naphthalene-2-carbonylamino)imidazole-4-carboxylate (PubChem CID 59303132) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is ethyl 3-benzyl-2-methylsulfanyl-5-(naphthalene-2-carbonylamino)imidazole-4-carboxylate.
| Compound Name | ethyl 3-benzyl-2-methylsulfanyl-5-(naphthalene-2-carbonylamino)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 59303132 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | ethyl 3-benzyl-2-methylsulfanyl-5-(naphthalene-2-carbonylamino)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc3ccccc3c2)nc(SC)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H23N3O3S/c1-3-31-24(30)21-22(27-25(32-2)28(21)16-17-9-5-4-6-10-17)26-23(29)20-14-13-18-11-7-8-12-19(18)15-20/h4-15H,3,16H2,1-2H3,(H,26,29) |
| InChIKey | GXHMZSKXAVDGBC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |