C22H25N3O3 — CID 59305557
N-(2-aminophenyl)-3-[1-[(3-methoxyphenyl)methyl]-6-oxo-2,3-dihydropyridin-5-yl]propanamide (PubChem CID 59305557) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[1-[(3-methoxyphenyl)methyl]-6-oxo-2,3-dihydropyridin-5-yl]propanamide.
| Compound Name | N-(2-aminophenyl)-3-[1-[(3-methoxyphenyl)methyl]-6-oxo-2,3-dihydropyridin-5-yl]propanamide |
|---|---|
| PubChem CID | 59305557 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-(2-aminophenyl)-3-[1-[(3-methoxyphenyl)methyl]-6-oxo-2,3-dihydropyridin-5-yl]propanamide |
| SMILES | COc1cccc(CN2CCC=C(CCC(=O)Nc3ccccc3N)C2=O)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-28-18-8-4-6-16(14-18)15-25-13-5-7-17(22(25)27)11-12-21(26)24-20-10-3-2-9-19(20)23/h2-4,6-10,14H,5,11-13,15,23H2,1H3,(H,24,26) |
| InChIKey | JMYVANXAPRRUQV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|