C23H24 — CID 59307414
1,3,5-trimethyl-2-[2-(4-prop-2-enylphenyl)cyclopenta-2,4-dien-1-yl]benzene (PubChem CID 59307414) has the molecular formula C23H24 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[2-(4-prop-2-enylphenyl)cyclopenta-2,4-dien-1-yl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[2-(4-prop-2-enylphenyl)cyclopenta-2,4-dien-1-yl]benzene |
|---|---|
| PubChem CID | 59307414 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1,3,5-trimethyl-2-[2-(4-prop-2-enylphenyl)cyclopenta-2,4-dien-1-yl]benzene |
| SMILES | C=CCc1ccc(C2=CC=CC2c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C23H24/c1-5-7-19-10-12-20(13-11-19)21-8-6-9-22(21)23-17(3)14-16(2)15-18(23)4/h5-6,8-15,22H,1,7H2,2-4H3 |
| InChIKey | KGXZKRNFZYBUHN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|