C40H36N2 — CID 59307596
1-phenyl-3-[2-[3-[2-(1-phenylindol-3-yl)propan-2-yl]phenyl]propan-2-yl]indole (PubChem CID 59307596) has the molecular formula C40H36N2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 1-phenyl-3-[2-[3-[2-(1-phenylindol-3-yl)propan-2-yl]phenyl]propan-2-yl]indole.
| Compound Name | 1-phenyl-3-[2-[3-[2-(1-phenylindol-3-yl)propan-2-yl]phenyl]propan-2-yl]indole |
|---|---|
| PubChem CID | 59307596 |
| Molecular Formula | C40H36N2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 1-phenyl-3-[2-[3-[2-(1-phenylindol-3-yl)propan-2-yl]phenyl]propan-2-yl]indole |
| SMILES | CC(C)(c1cccc(C(C)(C)c2cn(-c3ccccc3)c3ccccc23)c1)c1cn(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C40H36N2/c1-39(2,35-27-41(31-18-7-5-8-19-31)37-24-13-11-22-33(35)37)29-16-15-17-30(26-29)40(3,4)36-28-42(32-20-9-6-10-21-32)38-25-14-12-23-34(36)38/h5-28H,1-4H3 |
| InChIKey | VZGUCJRQJIGWRD-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |