C33H24N4 — CID 59307652
4-[3-[2-[1-(4-isocyanophenyl)indol-3-yl]propan-2-yl]indol-1-yl]benzonitrile (PubChem CID 59307652) has the molecular formula C33H24N4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 4-[3-[2-[1-(4-isocyanophenyl)indol-3-yl]propan-2-yl]indol-1-yl]benzonitrile.
| Compound Name | 4-[3-[2-[1-(4-isocyanophenyl)indol-3-yl]propan-2-yl]indol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 59307652 |
| Molecular Formula | C33H24N4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 4-[3-[2-[1-(4-isocyanophenyl)indol-3-yl]propan-2-yl]indol-1-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-n2cc(C(C)(C)c3cn(-c4ccc(C#N)cc4)c4ccccc34)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H24N4/c1-33(2,29-21-36(31-10-6-4-8-27(29)31)25-16-12-23(20-34)13-17-25)30-22-37(32-11-7-5-9-28(30)32)26-18-14-24(35-3)15-19-26/h4-19,21-22H,1-2H3 |
| InChIKey | XNUHOIOYEYXVBL-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|