C30H34N2 — CID 71026412
3-tert-butyl-1-[3-(3-tert-butyl-4,5-dihydroindol-1-yl)phenyl]indole (PubChem CID 71026412) has the molecular formula C30H34N2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 3-tert-butyl-1-[3-(3-tert-butyl-4,5-dihydroindol-1-yl)phenyl]indole.
| Compound Name | 3-tert-butyl-1-[3-(3-tert-butyl-4,5-dihydroindol-1-yl)phenyl]indole |
|---|---|
| PubChem CID | 71026412 |
| Molecular Formula | C30H34N2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-tert-butyl-1-[3-(3-tert-butyl-4,5-dihydroindol-1-yl)phenyl]indole |
| SMILES | CC(C)(C)c1cn(-c2cccc(-n3cc(C(C)(C)C)c4ccccc43)c2)c2c1CCC=C2 |
| InChI | InChI=1S/C30H34N2/c1-29(2,3)25-19-31(27-16-9-7-14-23(25)27)21-12-11-13-22(18-21)32-20-26(30(4,5)6)24-15-8-10-17-28(24)32/h7,9-14,16-20H,8,15H2,1-6H3 |
| InChIKey | NJPFQTPIHCWUFZ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |