C40H36N2 — CID 89217850
9-[4-[2-[4-[3-[(1Z,3Z)-penta-1,3-dienyl]indol-1-yl]phenyl]propan-2-yl]phenyl]-3,4-dihydrocarbazole (PubChem CID 89217850) has the molecular formula C40H36N2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 9-[4-[2-[4-[3-[(1Z,3Z)-penta-1,3-dienyl]indol-1-yl]phenyl]propan-2-yl]phenyl]-3,4-dihydrocarbazole.
| Compound Name | 9-[4-[2-[4-[3-[(1Z,3Z)-penta-1,3-dienyl]indol-1-yl]phenyl]propan-2-yl]phenyl]-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 89217850 |
| Molecular Formula | C40H36N2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 9-[4-[2-[4-[3-[(1Z,3Z)-penta-1,3-dienyl]indol-1-yl]phenyl]propan-2-yl]phenyl]-3,4-dihydrocarbazole |
| SMILES | C/C=C\C=C/c1cn(-c2ccc(C(C)(C)c3ccc(-n4c5c(c6ccccc64)CCC=C5)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C40H36N2/c1-4-5-6-13-29-28-41(37-17-10-7-14-34(29)37)32-24-20-30(21-25-32)40(2,3)31-22-26-33(27-23-31)42-38-18-11-8-15-35(38)36-16-9-12-19-39(36)42/h4-8,10-15,17-28H,9,16H2,1-3H3/b5-4-,13-6- |
| InChIKey | VNMXDTMYANHVCX-YIDBNINZSA-N |
| XLogP | 10.45 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|