C40H38IrN3O2- — CID 59307621
5-[5-(1-hydroxypyridin-1-ium-2-yl)-2-methyl-2-[(6-phenyl-3-pyridinyl)methyl]pentyl]-2-phenylpyridine;iridium;phenol (PubChem CID 59307621) has the molecular formula C40H38IrN3O2- and a molecular weight of 784.98 g/mol. Its IUPAC name is 5-[5-(1-hydroxypyridin-1-ium-2-yl)-2-methyl-2-[(6-phenyl-3-pyridinyl)methyl]pentyl]-2-phenylpyridine;iridium;phenol.
| Compound Name | 5-[5-(1-hydroxypyridin-1-ium-2-yl)-2-methyl-2-[(6-phenyl-3-pyridinyl)methyl]pentyl]-2-phenylpyridine;iridium;phenol |
|---|---|
| PubChem CID | 59307621 |
| Molecular Formula | C40H38IrN3O2- |
| Molecular Weight | 784.98 g/mol |
| Exact Mass | 785.26 |
| IUPAC Name | 5-[5-(1-hydroxypyridin-1-ium-2-yl)-2-methyl-2-[(6-phenyl-3-pyridinyl)methyl]pentyl]-2-phenylpyridine;iridium;phenol |
| SMILES | CC(CCCc1cccc[n+]1O)(Cc1ccc(-c2[c-]cccc2)nc1)Cc1ccc(-c2[c-]cccc2)nc1.Oc1ccccc1.[Ir] |
| InChI | InChI=1S/C34H32N3O.C6H6O.Ir/c1-34(21-10-16-31-15-8-9-22-37(31)38,23-27-17-19-32(35-25-27)29-11-4-2-5-12-29)24-28-18-20-33(36-26-28)30-13-6-3-7-14-30;7-6-4-2-1-3-5-6;/h2-9,11,13,15,17-20,22,25-26,38H,10,16,21,23-24H2,1H3;1-5,7H;/q-1;; |
| InChIKey | ZSIXNSRDQKAGJI-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.98 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|