C25H18F3N2OPt- — CID 58004243
platinum;2-[2-[6-(2,3,4-trifluoro-5-pyridin-2-ylbenzene-6-id-1-yl)-2-pyridinyl]propan-2-yl]phenol (PubChem CID 58004243) has the molecular formula C25H18F3N2OPt- and a molecular weight of 614.50 g/mol. Its IUPAC name is platinum;2-[2-[6-(2,3,4-trifluoro-5-pyridin-2-ylbenzene-6-id-1-yl)-2-pyridinyl]propan-2-yl]phenol.
| Compound Name | platinum;2-[2-[6-(2,3,4-trifluoro-5-pyridin-2-ylbenzene-6-id-1-yl)-2-pyridinyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 58004243 |
| Molecular Formula | C25H18F3N2OPt- |
| Molecular Weight | 614.50 g/mol |
| Exact Mass | 614.10 |
| IUPAC Name | platinum;2-[2-[6-(2,3,4-trifluoro-5-pyridin-2-ylbenzene-6-id-1-yl)-2-pyridinyl]propan-2-yl]phenol |
| SMILES | CC(C)(c1cccc(-c2[c-]c(-c3ccccn3)c(F)c(F)c2F)n1)c1ccccc1O.[Pt] |
| InChI | InChI=1S/C25H18F3N2O.Pt/c1-25(2,17-8-3-4-11-20(17)31)21-12-7-10-19(30-21)16-14-15(18-9-5-6-13-29-18)22(26)24(28)23(16)27;/h3-13,31H,1-2H3;/q-1; |
| InChIKey | JWATWGXTPCDEOX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|