C20H25F5O7 — CID 59310349
[4-acetyloxy-3,3-difluoro-4-methyl-5-(2-methylprop-2-enoyloxymethyl)-2-(trifluoromethyl)oxolan-2-yl] cyclohexanecarboxylate (PubChem CID 59310349) has the molecular formula C20H25F5O7 and a molecular weight of 472.40 g/mol. Its IUPAC name is [4-acetyloxy-3,3-difluoro-4-methyl-5-(2-methylprop-2-enoyloxymethyl)-2-(trifluoromethyl)oxolan-2-yl] cyclohexanecarboxylate.
| Compound Name | [4-acetyloxy-3,3-difluoro-4-methyl-5-(2-methylprop-2-enoyloxymethyl)-2-(trifluoromethyl)oxolan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 59310349 |
| Molecular Formula | C20H25F5O7 |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [4-acetyloxy-3,3-difluoro-4-methyl-5-(2-methylprop-2-enoyloxymethyl)-2-(trifluoromethyl)oxolan-2-yl] cyclohexanecarboxylate |
| SMILES | C=C(C)C(=O)OCC1OC(OC(=O)C2CCCCC2)(C(F)(F)F)C(F)(F)C1(C)OC(C)=O |
| InChI | InChI=1S/C20H25F5O7/c1-11(2)15(27)29-10-14-17(4,30-12(3)26)18(21,22)19(31-14,20(23,24)25)32-16(28)13-8-6-5-7-9-13/h13-14H,1,5-10H2,2-4H3 |
| InChIKey | CDMFDMLLZSTNQX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|