C16H19F5O7 — CID 59310403
[4,6-diacetyloxy-5,5-difluoro-4-methyl-6-(trifluoromethyl)oxan-3-yl]methyl 2-methylprop-2-enoate (PubChem CID 59310403) has the molecular formula C16H19F5O7 and a molecular weight of 418.31 g/mol. Its IUPAC name is [4,6-diacetyloxy-5,5-difluoro-4-methyl-6-(trifluoromethyl)oxan-3-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [4,6-diacetyloxy-5,5-difluoro-4-methyl-6-(trifluoromethyl)oxan-3-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59310403 |
| Molecular Formula | C16H19F5O7 |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [4,6-diacetyloxy-5,5-difluoro-4-methyl-6-(trifluoromethyl)oxan-3-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1COC(OC(C)=O)(C(F)(F)F)C(F)(F)C1(C)OC(C)=O |
| InChI | InChI=1S/C16H19F5O7/c1-8(2)12(24)25-6-11-7-26-15(16(19,20)21,28-10(4)23)14(17,18)13(11,5)27-9(3)22/h11H,1,6-7H2,2-5H3 |
| InChIKey | NZEHYUJCICVCOF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|