C23H25F5O7 — CID 59310483
[3,5-diacetyloxy-4,4-difluoro-5-(trifluoromethyl)oxolan-2-yl]methyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 59310483) has the molecular formula C23H25F5O7 and a molecular weight of 508.44 g/mol. Its IUPAC name is [3,5-diacetyloxy-4,4-difluoro-5-(trifluoromethyl)oxolan-2-yl]methyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | [3,5-diacetyloxy-4,4-difluoro-5-(trifluoromethyl)oxolan-2-yl]methyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 59310483 |
| Molecular Formula | C23H25F5O7 |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | [3,5-diacetyloxy-4,4-difluoro-5-(trifluoromethyl)oxolan-2-yl]methyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC(=O)OC1C(COC(=O)C2CC3CC2C2C4C=CC(C4)C32)OC(OC(C)=O)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C23H25F5O7/c1-9(29)33-19-16(35-22(21(19,24)25,23(26,27)28)34-10(2)30)8-32-20(31)15-7-13-6-14(15)18-12-4-3-11(5-12)17(13)18/h3-4,11-19H,5-8H2,1-2H3 |
| InChIKey | WDTBNQUMNOMSBU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|