C30H35BN2O10S — CID 59314999
[4-[(1R)-2-[[4-cyclopropylsulfonyl-3-[[methyl(phenylmethoxycarbonyl)amino]methyl]phenyl]carbamoyloxy]-1-(methoxymethoxy)ethyl]phenyl]boronic acid (PubChem CID 59314999) has the molecular formula C30H35BN2O10S and a molecular weight of 626.49 g/mol. Its IUPAC name is [4-[(1R)-2-[[4-cyclopropylsulfonyl-3-[[methyl(phenylmethoxycarbonyl)amino]methyl]phenyl]carbamoyloxy]-1-(methoxymethoxy)ethyl]phenyl]boronic acid.
| Compound Name | [4-[(1R)-2-[[4-cyclopropylsulfonyl-3-[[methyl(phenylmethoxycarbonyl)amino]methyl]phenyl]carbamoyloxy]-1-(methoxymethoxy)ethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 59314999 |
| Molecular Formula | C30H35BN2O10S |
| Molecular Weight | 626.49 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | [4-[(1R)-2-[[4-cyclopropylsulfonyl-3-[[methyl(phenylmethoxycarbonyl)amino]methyl]phenyl]carbamoyloxy]-1-(methoxymethoxy)ethyl]phenyl]boronic acid |
| SMILES | COCO[C@@H](COC(=O)Nc1ccc(S(=O)(=O)C2CC2)c(CN(C)C(=O)OCc2ccccc2)c1)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C30H35BN2O10S/c1-33(30(35)42-18-21-6-4-3-5-7-21)17-23-16-25(12-15-28(23)44(38,39)26-13-14-26)32-29(34)41-19-27(43-20-40-2)22-8-10-24(11-9-22)31(36)37/h3-12,15-16,26-27,36-37H,13-14,17-20H2,1-2H3,(H,32,34)/t27-/m0/s1 |
| InChIKey | FZRWKNOTDXBFSL-MHZLTWQESA-N |
| XLogP | 2.98 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|