C21H19N3O4S2 — CID 59316691
2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-1-phenylsulfanylperoxybenzimidazole (PubChem CID 59316691) has the molecular formula C21H19N3O4S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-1-phenylsulfanylperoxybenzimidazole.
| Compound Name | 2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-1-phenylsulfanylperoxybenzimidazole |
|---|---|
| PubChem CID | 59316691 |
| Molecular Formula | C21H19N3O4S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-1-phenylsulfanylperoxybenzimidazole |
| SMILES | COc1ccnc(CS(=O)c2nc3ccccc3n2OOSc2ccccc2)c1C |
| InChI | InChI=1S/C21H19N3O4S2/c1-15-18(22-13-12-20(15)26-2)14-30(25)21-23-17-10-6-7-11-19(17)24(21)27-28-29-16-8-4-3-5-9-16/h3-13H,14H2,1-2H3 |
| InChIKey | CTPKBZXCHOFKTL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|