C20H30BrNO4 — CID 59318320
tert-butyl 4-[[3-bromo-5-(2-methoxyethoxy)phenyl]methyl]piperidine-1-carboxylate (PubChem CID 59318320) has the molecular formula C20H30BrNO4 and a molecular weight of 428.37 g/mol. Its IUPAC name is tert-butyl 4-[[3-bromo-5-(2-methoxyethoxy)phenyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-bromo-5-(2-methoxyethoxy)phenyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59318320 |
| Molecular Formula | C20H30BrNO4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | tert-butyl 4-[[3-bromo-5-(2-methoxyethoxy)phenyl]methyl]piperidine-1-carboxylate |
| SMILES | COCCOc1cc(Br)cc(CC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H30BrNO4/c1-20(2,3)26-19(23)22-7-5-15(6-8-22)11-16-12-17(21)14-18(13-16)25-10-9-24-4/h12-15H,5-11H2,1-4H3 |
| InChIKey | JJNDNDINZLUBFH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|