C36H27AlN2O3S — CID 59318906
bis[(2-methylquinolin-8-yl)oxy]-[4-(5-phenylthiophen-2-yl)phenoxy]alumane (PubChem CID 59318906) has the molecular formula C36H27AlN2O3S and a molecular weight of 594.67 g/mol. Its IUPAC name is bis[(2-methylquinolin-8-yl)oxy]-[4-(5-phenylthiophen-2-yl)phenoxy]alumane.
| Compound Name | bis[(2-methylquinolin-8-yl)oxy]-[4-(5-phenylthiophen-2-yl)phenoxy]alumane |
|---|---|
| PubChem CID | 59318906 |
| Molecular Formula | C36H27AlN2O3S |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | bis[(2-methylquinolin-8-yl)oxy]-[4-(5-phenylthiophen-2-yl)phenoxy]alumane |
| SMILES | Cc1ccc2cccc(O[Al](Oc3ccc(-c4ccc(-c5ccccc5)s4)cc3)Oc3cccc4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/C16H12OS.2C10H9NO.Al/c17-14-8-6-13(7-9-14)16-11-10-15(18-16)12-4-2-1-3-5-12;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-11,17H;2*2-6,12H,1H3;/q;;;+3/p-3 |
| InChIKey | YBHTVMXTYAMCTR-UHFFFAOYSA-K |
| XLogP | 9.32 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |