C11H11N3O2 — CID 59320836
N-(2-imidazo[1,2-a]pyridin-7-yl-2-oxoethyl)acetamide (PubChem CID 59320836) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is N-(2-imidazo[1,2-a]pyridin-7-yl-2-oxoethyl)acetamide.
| Compound Name | N-(2-imidazo[1,2-a]pyridin-7-yl-2-oxoethyl)acetamide |
|---|---|
| PubChem CID | 59320836 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-(2-imidazo[1,2-a]pyridin-7-yl-2-oxoethyl)acetamide |
| SMILES | CC(=O)NCC(=O)c1ccn2ccnc2c1 |
| InChI | InChI=1S/C11H11N3O2/c1-8(15)13-7-10(16)9-2-4-14-5-3-12-11(14)6-9/h2-6H,7H2,1H3,(H,13,15) |
| InChIKey | LPIDEAZYLQUAMY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |