C31H36N2O6 — CID 59323925
methyl (2S,3R)-2-[(4-but-2-ynoxycyclohexanecarbonyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 59323925) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is methyl (2S,3R)-2-[(4-but-2-ynoxycyclohexanecarbonyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2S,3R)-2-[(4-but-2-ynoxycyclohexanecarbonyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 59323925 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | methyl (2S,3R)-2-[(4-but-2-ynoxycyclohexanecarbonyl)amino]-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | CC#CCOC1CCC(C(=O)N[C@H](C(=O)OC)[C@@H](C)NC(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C31H36N2O6/c1-4-5-18-38-22-16-14-21(15-17-22)29(34)33-28(30(35)37-3)20(2)32-31(36)39-19-27-25-12-8-6-10-23(25)24-11-7-9-13-26(24)27/h6-13,20-22,27-28H,14-19H2,1-3H3,(H,32,36)(H,33,34)/t20-,21?,22?,28+/m1/s1 |
| InChIKey | FQNAZBNQIFETAM-IXUCXVBKSA-N |
| XLogP | 4.17 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|