C18H22N2O4 — CID 59324668
ethyl 1-[(4-hydroxyoxan-4-yl)methyl]-5-phenylimidazole-4-carboxylate (PubChem CID 59324668) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl 1-[(4-hydroxyoxan-4-yl)methyl]-5-phenylimidazole-4-carboxylate.
| Compound Name | ethyl 1-[(4-hydroxyoxan-4-yl)methyl]-5-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 59324668 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl 1-[(4-hydroxyoxan-4-yl)methyl]-5-phenylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn(CC2(O)CCOCC2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c1-2-24-17(21)15-16(14-6-4-3-5-7-14)20(13-19-15)12-18(22)8-10-23-11-9-18/h3-7,13,22H,2,8-12H2,1H3 |
| InChIKey | TUBMGCRFSUXPKI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |