C24H28N2O3 — CID 59324725
ethyl 1-[(1S)-2-ethyl-2-hydroxy-1-phenylbutyl]-5-phenylimidazole-4-carboxylate (PubChem CID 59324725) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is ethyl 1-[(1S)-2-ethyl-2-hydroxy-1-phenylbutyl]-5-phenylimidazole-4-carboxylate.
| Compound Name | ethyl 1-[(1S)-2-ethyl-2-hydroxy-1-phenylbutyl]-5-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 59324725 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | ethyl 1-[(1S)-2-ethyl-2-hydroxy-1-phenylbutyl]-5-phenylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn([C@@H](c2ccccc2)C(O)(CC)CC)c1-c1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c1-4-24(28,5-2)22(19-15-11-8-12-16-19)26-17-25-20(23(27)29-6-3)21(26)18-13-9-7-10-14-18/h7-17,22,28H,4-6H2,1-3H3/t22-/m0/s1 |
| InChIKey | MNBZLJMWYATPMJ-QFIPXVFZSA-N |
| XLogP | 4.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |