C17H24N2O5 — CID 59325181
tert-butyl 3-(1,3-benzodioxol-5-yloxymethyl)piperazine-1-carboxylate (PubChem CID 59325181) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is tert-butyl 3-(1,3-benzodioxol-5-yloxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(1,3-benzodioxol-5-yloxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59325181 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | tert-butyl 3-(1,3-benzodioxol-5-yloxymethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC(COc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C17H24N2O5/c1-17(2,3)24-16(20)19-7-6-18-12(9-19)10-21-13-4-5-14-15(8-13)23-11-22-14/h4-5,8,12,18H,6-7,9-11H2,1-3H3 |
| InChIKey | RMQKYIALPLDZKI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |