C13H16N2O5 — CID 69263616
3-(1,3-benzodioxol-5-yloxymethyl)piperazine-1-carboxylic acid (PubChem CID 69263616) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxymethyl)piperazine-1-carboxylic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yloxymethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69263616 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxymethyl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCNC(COc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C13H16N2O5/c16-13(17)15-4-3-14-9(6-15)7-18-10-1-2-11-12(5-10)20-8-19-11/h1-2,5,9,14H,3-4,6-8H2,(H,16,17) |
| InChIKey | WOLNARIKANJCHF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |