C31H38N6O3Si — CID 59325391
tert-butyl N-[(2S)-1-[3-(1-methylpyrazol-4-yl)-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]propan-2-yl]carbamate (PubChem CID 59325391) has the molecular formula C31H38N6O3Si and a molecular weight of 570.77 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[3-(1-methylpyrazol-4-yl)-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[3-(1-methylpyrazol-4-yl)-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 59325391 |
| Molecular Formula | C31H38N6O3Si |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | tert-butyl N-[(2S)-1-[3-(1-methylpyrazol-4-yl)-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]propan-2-yl]carbamate |
| SMILES | C[C@@H](COc1cc(Nc2ncc3cc(C#C[Si](C)(C)C)ccc3n2)cc(-c2cnn(C)c2)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H38N6O3Si/c1-21(34-30(38)40-31(2,3)4)20-39-27-15-23(25-18-33-37(5)19-25)14-26(16-27)35-29-32-17-24-13-22(9-10-28(24)36-29)11-12-41(6,7)8/h9-10,13-19,21H,20H2,1-8H3,(H,34,38)(H,32,35,36)/t21-/m0/s1 |
| InChIKey | IJEXQZRCMOGXOC-NRFANRHFSA-N |
| XLogP | 6.29 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|