C26H16N4O2 — CID 59326958
3-[2-[4-(1H-benzimidazole-2-carbonyl)phenoxy]-3-pyridinyl]benzonitrile (PubChem CID 59326958) has the molecular formula C26H16N4O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 3-[2-[4-(1H-benzimidazole-2-carbonyl)phenoxy]-3-pyridinyl]benzonitrile.
| Compound Name | 3-[2-[4-(1H-benzimidazole-2-carbonyl)phenoxy]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 59326958 |
| Molecular Formula | C26H16N4O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-[2-[4-(1H-benzimidazole-2-carbonyl)phenoxy]-3-pyridinyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cccnc2Oc2ccc(C(=O)c3nc4ccccc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C26H16N4O2/c27-16-17-5-3-6-19(15-17)21-7-4-14-28-26(21)32-20-12-10-18(11-13-20)24(31)25-29-22-8-1-2-9-23(22)30-25/h1-15H,(H,29,30) |
| InChIKey | RUUYCBPQEDKWIK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |