About 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol
2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol (PubChem CID 59330633) has the molecular formula C5H8FN3O
and a molecular weight of 145.14 g/mol. Its IUPAC name is 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol |
| PubChem CID | 59330633 |
| Molecular Formula | C5H8FN3O |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol |
| SMILES | Cn1cnc(C(O)CF)n1 |
| InChI | InChI=1S/C5H8FN3O/c1-9-3-7-5(8-9)4(10)2-6/h3-4,10H,2H2,1H3 |
| InChIKey | JDYUEQMERIQZAF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol?
The IUPAC name of 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol (CID 59330633) is 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol.
What is the SMILES notation for 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol?
The canonical SMILES for 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol is Cn1cnc(C(O)CF)n1.
What is the InChIKey of 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol?
The InChIKey is JDYUEQMERIQZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN3O/c1-9-3-7-5(8-9)4(10)2-6/h3-4,10H,2H2,1H3.
What are the key properties of 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol?
2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol has a molecular weight of 145.14 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-(1-methyl-1,2,4-triazol-3-yl)ethanol is sourced from PubChem (CID 59330633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).