C22H27N3O2S — CID 59331505
4-[5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrol-2-yl]-1-methylimidazole (PubChem CID 59331505) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 4-[5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrol-2-yl]-1-methylimidazole.
| Compound Name | 4-[5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrol-2-yl]-1-methylimidazole |
|---|---|
| PubChem CID | 59331505 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-[5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrol-2-yl]-1-methylimidazole |
| SMILES | Cn1cnc(-c2ccc(C(CC3CCCC3)c3ccc(S(C)(=O)=O)cc3)[nH]2)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-25-14-22(23-15-25)21-12-11-20(24-21)19(13-16-5-3-4-6-16)17-7-9-18(10-8-17)28(2,26)27/h7-12,14-16,19,24H,3-6,13H2,1-2H3 |
| InChIKey | OFGNRGNALVUYOE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |