C22H29NO4S — CID 59331259
ethyl 5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-3-methyl-1H-pyrrole-2-carboxylate (PubChem CID 59331259) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is ethyl 5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-3-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-3-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 59331259 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | ethyl 5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-3-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C(CC2CCCC2)c2ccc(S(C)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C22H29NO4S/c1-4-27-22(24)21-15(2)13-20(23-21)19(14-16-7-5-6-8-16)17-9-11-18(12-10-17)28(3,25)26/h9-13,16,19,23H,4-8,14H2,1-3H3 |
| InChIKey | CSFPDGWRUJSBRK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |