C45H50N4O — CID 151469768
2,4-bis[4-[2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]phenyl]pentan-3-one (PubChem CID 151469768) has the molecular formula C45H50N4O and a molecular weight of 662.92 g/mol. Its IUPAC name is 2,4-bis[4-[2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]phenyl]pentan-3-one.
| Compound Name | 2,4-bis[4-[2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]phenyl]pentan-3-one |
|---|---|
| PubChem CID | 151469768 |
| Molecular Formula | C45H50N4O |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | 2,4-bis[4-[2-cyclopentyl-1-(1H-pyrrolo[2,3-b]pyridin-2-yl)ethyl]phenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1ccc(C(CC2CCCC2)c2cc3cccnc3[nH]2)cc1)c1ccc(C(CC2CCCC2)c2cc3cccnc3[nH]2)cc1 |
| InChI | InChI=1S/C45H50N4O/c1-29(33-15-19-35(20-16-33)39(25-31-9-3-4-10-31)41-27-37-13-7-23-46-44(37)48-41)43(50)30(2)34-17-21-36(22-18-34)40(26-32-11-5-6-12-32)42-28-38-14-8-24-47-45(38)49-42/h7-8,13-24,27-32,39-40H,3-6,9-12,25-26H2,1-2H3,(H,46,48)(H,47,49) |
| InChIKey | PKFHTSHUUFBCTP-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |