C24H30ClN2O3P — CID 127041335
2-[1-(3-chloro-4-diethoxyphosphorylphenyl)-2-cyclopentylethyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 127041335) has the molecular formula C24H30ClN2O3P and a molecular weight of 460.94 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-diethoxyphosphorylphenyl)-2-cyclopentylethyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 2-[1-(3-chloro-4-diethoxyphosphorylphenyl)-2-cyclopentylethyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 127041335 |
| Molecular Formula | C24H30ClN2O3P |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[1-(3-chloro-4-diethoxyphosphorylphenyl)-2-cyclopentylethyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCOP(=O)(OCC)c1ccc(C(CC2CCCC2)c2cc3cccnc3[nH]2)cc1Cl |
| InChI | InChI=1S/C24H30ClN2O3P/c1-3-29-31(28,30-4-2)23-12-11-18(15-21(23)25)20(14-17-8-5-6-9-17)22-16-19-10-7-13-26-24(19)27-22/h7,10-13,15-17,20H,3-6,8-9,14H2,1-2H3,(H,26,27) |
| InChIKey | SLFBSIWNCQBWFP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|