C20H25NO4S — CID 59331360
5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-3-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 59331360) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is 5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-3-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-3-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 59331360 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 5-[2-cyclopentyl-1-(4-methylsulfonylphenyl)ethyl]-3-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(C(CC2CCCC2)c2ccc(S(C)(=O)=O)cc2)[nH]c1C(=O)O |
| InChI | InChI=1S/C20H25NO4S/c1-13-11-18(21-19(13)20(22)23)17(12-14-5-3-4-6-14)15-7-9-16(10-8-15)26(2,24)25/h7-11,14,17,21H,3-6,12H2,1-2H3,(H,22,23) |
| InChIKey | NZGVHGCEMFDAOH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |