C21H34O3 — CID 59331903
(6R,8R,9S,10R,13S,14S,17S)-6-(methoxymethyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 59331903) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (6R,8R,9S,10R,13S,14S,17S)-6-(methoxymethyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (6R,8R,9S,10R,13S,14S,17S)-6-(methoxymethyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 59331903 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (6R,8R,9S,10R,13S,14S,17S)-6-(methoxymethyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | COC[C@@H]1C[C@H]2[C@@H]3CC[C@H](O)[C@@]3(C)CC[C@@H]2[C@@]2(C)C=CC(O)CC12 |
| InChI | InChI=1S/C21H34O3/c1-20-8-6-14(22)11-18(20)13(12-24-3)10-15-16-4-5-19(23)21(16,2)9-7-17(15)20/h6,8,13-19,22-23H,4-5,7,9-12H2,1-3H3/t13-,14?,15-,16-,17-,18?,19-,20+,21-/m0/s1 |
| InChIKey | SVUFRWUSIYEGBK-WCYPQXNZSA-N |
| XLogP | 3.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|