C19H18ClN5O — CID 59333833
4-chloro-6-morpholin-4-yl-N-(3-pyridin-3-ylphenyl)pyrimidin-2-amine (PubChem CID 59333833) has the molecular formula C19H18ClN5O and a molecular weight of 367.84 g/mol. Its IUPAC name is 4-chloro-6-morpholin-4-yl-N-(3-pyridin-3-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-6-morpholin-4-yl-N-(3-pyridin-3-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59333833 |
| Molecular Formula | C19H18ClN5O |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-chloro-6-morpholin-4-yl-N-(3-pyridin-3-ylphenyl)pyrimidin-2-amine |
| SMILES | Clc1cc(N2CCOCC2)nc(Nc2cccc(-c3cccnc3)c2)n1 |
| InChI | InChI=1S/C19H18ClN5O/c20-17-12-18(25-7-9-26-10-8-25)24-19(23-17)22-16-5-1-3-14(11-16)15-4-2-6-21-13-15/h1-6,11-13H,7-10H2,(H,22,23,24) |
| InChIKey | BDOZBTCUCOZQHN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |