C25H20ClNO4 — CID 59335849
2-[[6-(4-chlorophenyl)-3-methyl-1-benzofuran-2-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 59335849) has the molecular formula C25H20ClNO4 and a molecular weight of 433.89 g/mol. Its IUPAC name is 2-[[6-(4-chlorophenyl)-3-methyl-1-benzofuran-2-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-(4-chlorophenyl)-3-methyl-1-benzofuran-2-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 59335849 |
| Molecular Formula | C25H20ClNO4 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 2-[[6-(4-chlorophenyl)-3-methyl-1-benzofuran-2-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1c(C(=O)NC(Cc2ccccc2)C(=O)O)oc2cc(-c3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C25H20ClNO4/c1-15-20-12-9-18(17-7-10-19(26)11-8-17)14-22(20)31-23(15)24(28)27-21(25(29)30)13-16-5-3-2-4-6-16/h2-12,14,21H,13H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | ZIPORPLMIAEWKN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |