About [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea
[2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea (PubChem CID 59337688) has the molecular formula C18H21N3S
and a molecular weight of 311.45 g/mol. Its IUPAC name is [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea.
Molecular Properties
| Compound Name | [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea |
| PubChem CID | 59337688 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea |
| SMILES | CC1(C)CCN(c2ccccc2NC(N)=S)c2ccccc21 |
| InChI | InChI=1S/C18H21N3S/c1-18(2)11-12-21(15-9-5-3-7-13(15)18)16-10-6-4-8-14(16)20-17(19)22/h3-10H,11-12H2,1-2H3,(H3,19,20,22) |
| InChIKey | LVJHMSWLKXUGKJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea?
The IUPAC name of [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea (CID 59337688) is [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea.
What is the SMILES notation for [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea?
The canonical SMILES for [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea is CC1(C)CCN(c2ccccc2NC(N)=S)c2ccccc21.
What is the InChIKey of [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea?
The InChIKey is LVJHMSWLKXUGKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3S/c1-18(2)11-12-21(15-9-5-3-7-13(15)18)16-10-6-4-8-14(16)20-17(19)22/h3-10H,11-12H2,1-2H3,(H3,19,20,22).
What are the key properties of [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea?
[2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea has a molecular weight of 311.45 g/mol, XLogP of 4.16, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea is sourced from PubChem (CID 59337688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).