C18H21N3S — CID 59337688
[2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea (PubChem CID 59337688) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea.
| Compound Name | [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 59337688 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [2-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)phenyl]thiourea |
| SMILES | CC1(C)CCN(c2ccccc2NC(N)=S)c2ccccc21 |
| InChI | InChI=1S/C18H21N3S/c1-18(2)11-12-21(15-9-5-3-7-13(15)18)16-10-6-4-8-14(16)20-17(19)22/h3-10H,11-12H2,1-2H3,(H3,19,20,22) |
| InChIKey | LVJHMSWLKXUGKJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|