C9H14N2 — CID 59339963
3-ethenyl-1-ethyl-2,5-dimethyl-4H-imidazol-3-ium-4-ide (PubChem CID 59339963) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-ethenyl-1-ethyl-2,5-dimethyl-4H-imidazol-3-ium-4-ide.
| Compound Name | 3-ethenyl-1-ethyl-2,5-dimethyl-4H-imidazol-3-ium-4-ide |
|---|---|
| PubChem CID | 59339963 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-ethenyl-1-ethyl-2,5-dimethyl-4H-imidazol-3-ium-4-ide |
| SMILES | C=C[n+]1[c-]c(C)n(CC)c1C |
| InChI | InChI=1S/C9H14N2/c1-5-10-7-8(3)11(6-2)9(10)4/h5H,1,6H2,2-4H3 |
| InChIKey | FZCPQUKBRWUWMB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|