C52H66N2O4 — CID 59342729
1-(4-butoxy-3,5-dimethylanilino)-5-[3,5-dimethyl-4-[[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]anilino]anthracene-9,10-dione (PubChem CID 59342729) has the molecular formula C52H66N2O4 and a molecular weight of 783.11 g/mol. Its IUPAC name is 1-(4-butoxy-3,5-dimethylanilino)-5-[3,5-dimethyl-4-[[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]anilino]anthracene-9,10-dione.
| Compound Name | 1-(4-butoxy-3,5-dimethylanilino)-5-[3,5-dimethyl-4-[[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]anilino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 59342729 |
| Molecular Formula | C52H66N2O4 |
| Molecular Weight | 783.11 g/mol |
| Exact Mass | 782.50 |
| IUPAC Name | 1-(4-butoxy-3,5-dimethylanilino)-5-[3,5-dimethyl-4-[[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]anilino]anthracene-9,10-dione |
| SMILES | CCCCCC1CCC(C2CCC(COc3c(C)cc(Nc4cccc5c4C(=O)c4cccc(Nc6cc(C)c(OCCCC)c(C)c6)c4C5=O)cc3C)CC2)CC1 |
| InChI | InChI=1S/C52H66N2O4/c1-7-9-11-14-37-19-23-39(24-20-37)40-25-21-38(22-26-40)32-58-52-35(5)30-42(31-36(52)6)54-46-18-13-16-44-48(46)50(56)43-15-12-17-45(47(43)49(44)55)53-41-28-33(3)51(34(4)29-41)57-27-10-8-2/h12-13,15-18,28-31,37-40,53-54H,7-11,14,19-27,32H2,1-6H3 |
| InChIKey | DBJQZVHKJBHJAU-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.11 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|