C16H8IrNO2- — CID 59342938
iridium;10H-isochromeno[4,3-c]isoquinolin-10-id-6-one (PubChem CID 59342938) has the molecular formula C16H8IrNO2- and a molecular weight of 438.46 g/mol. Its IUPAC name is iridium;10H-isochromeno[4,3-c]isoquinolin-10-id-6-one.
| Compound Name | iridium;10H-isochromeno[4,3-c]isoquinolin-10-id-6-one |
|---|---|
| PubChem CID | 59342938 |
| Molecular Formula | C16H8IrNO2- |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | iridium;10H-isochromeno[4,3-c]isoquinolin-10-id-6-one |
| SMILES | O=c1oc2c3ccccc3cnc2c2[c-]cccc12.[Ir] |
| InChI | InChI=1S/C16H8NO2.Ir/c18-16-13-8-4-3-7-12(13)14-15(19-16)11-6-2-1-5-10(11)9-17-14;/h1-6,8-9H;/q-1; |
| InChIKey | OJYDRCSSTVAAFC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|