About iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile
iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile (PubChem CID 59342939) has the molecular formula C13H5IrN2O2-
and a molecular weight of 413.41 g/mol. Its IUPAC name is iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile.
Molecular Properties
| Compound Name | iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile |
| PubChem CID | 59342939 |
| Molecular Formula | C13H5IrN2O2- |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile |
| SMILES | N#Cc1c[c-]c2c(c1)c(=O)oc1cccnc12.[Ir] |
| InChI | InChI=1S/C13H5N2O2.Ir/c14-7-8-3-4-9-10(6-8)13(16)17-11-2-1-5-15-12(9)11;/h1-3,5-6H;/q-1; |
| InChIKey | WGPVZFFIDVMBCD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile?
The IUPAC name of iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile (CID 59342939) is iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile.
What is the SMILES notation for iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile?
The canonical SMILES for iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile is N#Cc1c[c-]c2c(c1)c(=O)oc1cccnc12.[Ir].
What is the InChIKey of iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile?
The InChIKey is WGPVZFFIDVMBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5N2O2.Ir/c14-7-8-3-4-9-10(6-8)13(16)17-11-2-1-5-15-12(9)11;/h1-3,5-6H;/q-1;.
What are the key properties of iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile?
iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile has a molecular weight of 413.41 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;6-oxo-10H-isochromeno[4,3-b]pyridin-10-ide-8-carbonitrile is sourced from PubChem (CID 59342939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).