C18H22LiNO5S — CID 59343960
lithium 2-[bis(2-hydroxy-1-phenylethyl)amino]ethanesulfonate (PubChem CID 59343960) has the molecular formula C18H22LiNO5S and a molecular weight of 371.38 g/mol. Its IUPAC name is lithium 2-[bis(2-hydroxy-1-phenylethyl)amino]ethanesulfonate.
| Compound Name | lithium 2-[bis(2-hydroxy-1-phenylethyl)amino]ethanesulfonate |
|---|---|
| PubChem CID | 59343960 |
| Molecular Formula | C18H22LiNO5S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | lithium 2-[bis(2-hydroxy-1-phenylethyl)amino]ethanesulfonate |
| SMILES | O=S(=O)([O-])CCN(C(CO)c1ccccc1)C(CO)c1ccccc1.[Li+] |
| InChI | InChI=1S/C18H23NO5S.Li/c20-13-17(15-7-3-1-4-8-15)19(11-12-25(22,23)24)18(14-21)16-9-5-2-6-10-16;/h1-10,17-18,20-21H,11-14H2,(H,22,23,24);/q;+1/p-1 |
| InChIKey | XHZRYSRHBLNKFM-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|