C37H65N9O6 — CID 59344602
N-[(3S,9S,15S)-11,17-bis[6-(methylamino)hexanoylamino]-2,8,14-trioxo-1,7,13-triazatetracyclo[13.3.0.03,7.09,13]octadecan-5-yl]-7-(methylamino)heptanamide (PubChem CID 59344602) has the molecular formula C37H65N9O6 and a molecular weight of 731.98 g/mol. Its IUPAC name is N-[(3S,9S,15S)-11,17-bis[6-(methylamino)hexanoylamino]-2,8,14-trioxo-1,7,13-triazatetracyclo[13.3.0.03,7.09,13]octadecan-5-yl]-7-(methylamino)heptanamide.
| Compound Name | N-[(3S,9S,15S)-11,17-bis[6-(methylamino)hexanoylamino]-2,8,14-trioxo-1,7,13-triazatetracyclo[13.3.0.03,7.09,13]octadecan-5-yl]-7-(methylamino)heptanamide |
|---|---|
| PubChem CID | 59344602 |
| Molecular Formula | C37H65N9O6 |
| Molecular Weight | 731.98 g/mol |
| Exact Mass | 731.51 |
| IUPAC Name | N-[(3S,9S,15S)-11,17-bis[6-(methylamino)hexanoylamino]-2,8,14-trioxo-1,7,13-triazatetracyclo[13.3.0.03,7.09,13]octadecan-5-yl]-7-(methylamino)heptanamide |
| SMILES | CNCCCCCCC(=O)NC1C[C@H]2C(=O)N3CC(NC(=O)CCCCCNC)C[C@H]3C(=O)N3CC(NC(=O)CCCCCNC)C[C@H]3C(=O)N2C1 |
| InChI | InChI=1S/C37H65N9O6/c1-38-17-11-5-4-8-14-32(47)41-26-20-29-35(50)45-24-28(43-34(49)16-10-7-13-19-40-3)22-31(45)37(52)46-25-27(21-30(46)36(51)44(29)23-26)42-33(48)15-9-6-12-18-39-2/h26-31,38-40H,4-25H2,1-3H3,(H,41,47)(H,42,48)(H,43,49)/t26?,27?,28?,29-,30-,31-/m0/s1 |
| InChIKey | RVXUVQUTYUCCJX-HAZJFTEDSA-N |
| XLogP | -0.01 |
| TPSA | 184.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.98 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|