C22H36N2O — CID 59345626
N-butyl-N-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 59345626) has the molecular formula C22H36N2O and a molecular weight of 344.54 g/mol. Its IUPAC name is N-butyl-N-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | N-butyl-N-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 59345626 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | N-butyl-N-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CCCCN(C(=O)c1ccccc1)C1CC(C)(C)N(CC)C(C)(C)C1 |
| InChI | InChI=1S/C22H36N2O/c1-7-9-15-23(20(25)18-13-11-10-12-14-18)19-16-21(3,4)24(8-2)22(5,6)17-19/h10-14,19H,7-9,15-17H2,1-6H3 |
| InChIKey | GGEVFGJQVULGJJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |